C22H23FN2O7 — CID 89116294
(2S)-2-[2-[4-[4-(fluoromethyl)benzoyl]oxyphenyl]ethylcarbamoylamino]pentanedioic acid (PubChem CID 89116294) has the molecular formula C22H23FN2O7 and a molecular weight of 446.43 g/mol. Its IUPAC name is (2S)-2-[2-[4-[4-(fluoromethyl)benzoyl]oxyphenyl]ethylcarbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[2-[4-[4-(fluoromethyl)benzoyl]oxyphenyl]ethylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 89116294 |
| Molecular Formula | C22H23FN2O7 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (2S)-2-[2-[4-[4-(fluoromethyl)benzoyl]oxyphenyl]ethylcarbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NCCc1ccc(OC(=O)c2ccc(CF)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C22H23FN2O7/c23-13-15-1-5-16(6-2-15)21(30)32-17-7-3-14(4-8-17)11-12-24-22(31)25-18(20(28)29)9-10-19(26)27/h1-8,18H,9-13H2,(H,26,27)(H,28,29)(H2,24,25,31)/t18-/m0/s1 |
| InChIKey | UHMLSAORVDSJCB-SFHVURJKSA-N |
| XLogP | 2.54 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|