C19H27AtN4O8 — CID 145300735
2-(carboxymethylcarbamoylamino)pentanedioic acid;[4-[2-(propanoylamino)ethyl]anilino]astatine (PubChem CID 145300735) has the molecular formula C19H27AtN4O8 and a molecular weight of 649.45 g/mol. Its IUPAC name is 2-(carboxymethylcarbamoylamino)pentanedioic acid;[4-[2-(propanoylamino)ethyl]anilino]astatine.
| Compound Name | 2-(carboxymethylcarbamoylamino)pentanedioic acid;[4-[2-(propanoylamino)ethyl]anilino]astatine |
|---|---|
| PubChem CID | 145300735 |
| Molecular Formula | C19H27AtN4O8 |
| Molecular Weight | 649.45 g/mol |
| Exact Mass | 649.17 |
| IUPAC Name | 2-(carboxymethylcarbamoylamino)pentanedioic acid;[4-[2-(propanoylamino)ethyl]anilino]astatine |
| SMILES | CCC(=O)NCCc1ccc(N[At])cc1.O=C(O)CCC(NC(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H15AtN2O.C8H12N2O7/c1-2-11(15)13-8-7-9-3-5-10(14-12)6-4-9;11-5(12)2-1-4(7(15)16)10-8(17)9-3-6(13)14/h3-6,14H,2,7-8H2,1H3,(H,13,15);4H,1-3H2,(H,11,12)(H,13,14)(H,15,16)(H2,9,10,17) |
| InChIKey | BKJCLICSABXLLN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 194.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.45 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |