C18H32N4O10 — CID 145023152
2-amino-6-(butylamino)-6-oxohexanoic acid;2-(carboxymethylcarbamoylamino)pentanedioic acid (PubChem CID 145023152) has the molecular formula C18H32N4O10 and a molecular weight of 464.47 g/mol. Its IUPAC name is 2-amino-6-(butylamino)-6-oxohexanoic acid;2-(carboxymethylcarbamoylamino)pentanedioic acid.
| Compound Name | 2-amino-6-(butylamino)-6-oxohexanoic acid;2-(carboxymethylcarbamoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 145023152 |
| Molecular Formula | C18H32N4O10 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-amino-6-(butylamino)-6-oxohexanoic acid;2-(carboxymethylcarbamoylamino)pentanedioic acid |
| SMILES | CCCCNC(=O)CCCC(N)C(=O)O.O=C(O)CCC(NC(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H20N2O3.C8H12N2O7/c1-2-3-7-12-9(13)6-4-5-8(11)10(14)15;11-5(12)2-1-4(7(15)16)10-8(17)9-3-6(13)14/h8H,2-7,11H2,1H3,(H,12,13)(H,14,15);4H,1-3H2,(H,11,12)(H,13,14)(H,15,16)(H2,9,10,17) |
| InChIKey | SHFWYSIZZQFWLW-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 245.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|