C21H22N2O7 — CID 89116297
(2S)-2-[2-(4-benzoyloxyphenyl)ethylcarbamoylamino]pentanedioic acid (PubChem CID 89116297) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is (2S)-2-[2-(4-benzoyloxyphenyl)ethylcarbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[2-(4-benzoyloxyphenyl)ethylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 89116297 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (2S)-2-[2-(4-benzoyloxyphenyl)ethylcarbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NCCc1ccc(OC(=O)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H22N2O7/c24-18(25)11-10-17(19(26)27)23-21(29)22-13-12-14-6-8-16(9-7-14)30-20(28)15-4-2-1-3-5-15/h1-9,17H,10-13H2,(H,24,25)(H,26,27)(H2,22,23,29)/t17-/m0/s1 |
| InChIKey | IQTVHFOJXHJMGQ-KRWDZBQOSA-N |
| XLogP | 2.07 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|