C24H23N5O6 — CID 101483542
(2,5-dioxopyrrolidin-1-yl) (2S)-6-azido-2-[(4-benzoylbenzoyl)amino]hexanoate (PubChem CID 101483542) has the molecular formula C24H23N5O6 and a molecular weight of 477.48 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S)-6-azido-2-[(4-benzoylbenzoyl)amino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S)-6-azido-2-[(4-benzoylbenzoyl)amino]hexanoate |
|---|---|
| PubChem CID | 101483542 |
| Molecular Formula | C24H23N5O6 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-6-azido-2-[(4-benzoylbenzoyl)amino]hexanoate |
| SMILES | [N-]=[N+]=NCCCC[C@H](NC(=O)c1ccc(C(=O)c2ccccc2)cc1)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H23N5O6/c25-28-26-15-5-4-8-19(24(34)35-29-20(30)13-14-21(29)31)27-23(33)18-11-9-17(10-12-18)22(32)16-6-2-1-3-7-16/h1-3,6-7,9-12,19H,4-5,8,13-15H2,(H,27,33)/t19-/m0/s1 |
| InChIKey | WCMCDYPPHGMFAU-IBGZPJMESA-N |
| XLogP | 3.10 |
| TPSA | 158.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|