C14H23N5O5 — CID 139351749
(2,5-dioxopyrrolidin-1-yl) (2S)-6-(diaminomethylideneamino)-2-(propanoylamino)hexanoate (PubChem CID 139351749) has the molecular formula C14H23N5O5 and a molecular weight of 341.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S)-6-(diaminomethylideneamino)-2-(propanoylamino)hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S)-6-(diaminomethylideneamino)-2-(propanoylamino)hexanoate |
|---|---|
| PubChem CID | 139351749 |
| Molecular Formula | C14H23N5O5 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-6-(diaminomethylideneamino)-2-(propanoylamino)hexanoate |
| SMILES | CCC(=O)N[C@@H](CCCCN=C(N)N)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H23N5O5/c1-2-10(20)18-9(5-3-4-8-17-14(15)16)13(23)24-19-11(21)6-7-12(19)22/h9H,2-8H2,1H3,(H,18,20)(H4,15,16,17)/t9-/m0/s1 |
| InChIKey | OWEWABVFSMUBOY-VIFPVBQESA-N |
| XLogP | -1.07 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|