C13H23N5O4 — CID 20641312
(2,5-dioxopyrrolidin-1-yl) 2-(methylamino)-5-[methyl-(N'-methylcarbamimidoyl)amino]pentanoate (PubChem CID 20641312) has the molecular formula C13H23N5O4 and a molecular weight of 313.36 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(methylamino)-5-[methyl-(N'-methylcarbamimidoyl)amino]pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(methylamino)-5-[methyl-(N'-methylcarbamimidoyl)amino]pentanoate |
|---|---|
| PubChem CID | 20641312 |
| Molecular Formula | C13H23N5O4 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(methylamino)-5-[methyl-(N'-methylcarbamimidoyl)amino]pentanoate |
| SMILES | C/N=C(\N)N(C)CCCC(NC)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H23N5O4/c1-15-9(5-4-8-17(3)13(14)16-2)12(21)22-18-10(19)6-7-11(18)20/h9,15H,4-8H2,1-3H3,(H2,14,16) |
| InChIKey | OVMOBTWKBOURTN-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|