C15H26N4O5S — CID 138456759
(2,5-dioxopyrrolidin-1-yl) 4-[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]sulfanyl-2-(methylamino)butanoate (PubChem CID 138456759) has the molecular formula C15H26N4O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]sulfanyl-2-(methylamino)butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]sulfanyl-2-(methylamino)butanoate |
|---|---|
| PubChem CID | 138456759 |
| Molecular Formula | C15H26N4O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]sulfanyl-2-(methylamino)butanoate |
| SMILES | CNC(CCSCC(=O)NCCN(C)C)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H26N4O5S/c1-16-11(15(23)24-19-13(21)4-5-14(19)22)6-9-25-10-12(20)17-7-8-18(2)3/h11,16H,4-10H2,1-3H3,(H,17,20) |
| InChIKey | POPXPXLELWQAJS-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|