C13H21N3O5 — CID 58840414
(2,5-dioxopyrrolidin-1-yl) 2-(methylamino)-5-oxo-5-(propylamino)pentanoate (PubChem CID 58840414) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(methylamino)-5-oxo-5-(propylamino)pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(methylamino)-5-oxo-5-(propylamino)pentanoate |
|---|---|
| PubChem CID | 58840414 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(methylamino)-5-oxo-5-(propylamino)pentanoate |
| SMILES | CCCNC(=O)CCC(NC)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H21N3O5/c1-3-8-15-10(17)5-4-9(14-2)13(20)21-16-11(18)6-7-12(16)19/h9,14H,3-8H2,1-2H3,(H,15,17) |
| InChIKey | VAEIYCAJGDNHRS-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|