C29H41N9O7 — CID 162650678
(2,5-dioxopyrrolidin-1-yl) 4-[[4-[[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]carbamoyl]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 162650678) has the molecular formula C29H41N9O7 and a molecular weight of 627.70 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[4-[[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]carbamoyl]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[4-[[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]carbamoyl]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 162650678 |
| Molecular Formula | C29H41N9O7 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.31 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[4-[[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]carbamoyl]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | [N-]=[N+]=NCCCC[C@H](NC(=O)CCCCCNC(=O)c1ccc(CN2CCN(C(=O)ON3C(=O)CCC3=O)CC2)cc1)C(N)=O |
| InChI | InChI=1S/C29H41N9O7/c30-27(42)23(6-3-5-15-33-35-31)34-24(39)7-2-1-4-14-32-28(43)22-10-8-21(9-11-22)20-36-16-18-37(19-17-36)29(44)45-38-25(40)12-13-26(38)41/h8-11,23H,1-7,12-20H2,(H2,30,42)(H,32,43)(H,34,39)/t23-/m0/s1 |
| InChIKey | GUZLEZSUDQZFKB-QHCPKHFHSA-N |
| XLogP | 1.75 |
| TPSA | 220.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|