C13H26N6O3 — CID 139364815
(2S)-2-(5-azidopentanoylamino)-6-(1-hydroxyethylamino)hexanamide (PubChem CID 139364815) has the molecular formula C13H26N6O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2S)-2-(5-azidopentanoylamino)-6-(1-hydroxyethylamino)hexanamide.
| Compound Name | (2S)-2-(5-azidopentanoylamino)-6-(1-hydroxyethylamino)hexanamide |
|---|---|
| PubChem CID | 139364815 |
| Molecular Formula | C13H26N6O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (2S)-2-(5-azidopentanoylamino)-6-(1-hydroxyethylamino)hexanamide |
| SMILES | CC(O)NCCCC[C@H](NC(=O)CCCCN=[N+]=[N-])C(N)=O |
| InChI | InChI=1S/C13H26N6O3/c1-10(20)16-8-4-2-6-11(13(14)22)18-12(21)7-3-5-9-17-19-15/h10-11,16,20H,2-9H2,1H3,(H2,14,22)(H,18,21)/t10?,11-/m0/s1 |
| InChIKey | CVTYESHVMQEIAE-DTIOYNMSSA-N |
| XLogP | 0.54 |
| TPSA | 153.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|