C27H39N11O4 — CID 162671708
N-[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]-4-[[4-(triazole-1-carbonyl)piperazin-1-yl]methyl]benzamide (PubChem CID 162671708) has the molecular formula C27H39N11O4 and a molecular weight of 581.68 g/mol. Its IUPAC name is N-[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]-4-[[4-(triazole-1-carbonyl)piperazin-1-yl]methyl]benzamide.
| Compound Name | N-[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]-4-[[4-(triazole-1-carbonyl)piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 162671708 |
| Molecular Formula | C27H39N11O4 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | N-[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]-4-[[4-(triazole-1-carbonyl)piperazin-1-yl]methyl]benzamide |
| SMILES | [N-]=[N+]=NCCCC[C@H](NC(=O)CCCCCNC(=O)c1ccc(CN2CCN(C(=O)n3ccnn3)CC2)cc1)C(N)=O |
| InChI | InChI=1S/C27H39N11O4/c28-25(40)23(6-3-5-13-31-34-29)33-24(39)7-2-1-4-12-30-26(41)22-10-8-21(9-11-22)20-36-16-18-37(19-17-36)27(42)38-15-14-32-35-38/h8-11,14-15,23H,1-7,12-13,16-20H2,(H2,28,40)(H,30,41)(H,33,39)/t23-/m0/s1 |
| InChIKey | TYEAHQVFKJKULY-QHCPKHFHSA-N |
| XLogP | 1.80 |
| TPSA | 204.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|