C11H11NO5 — CID 125484351
(2S)-2-[(4-formylbenzoyl)amino]-3-hydroxypropanoic acid (PubChem CID 125484351) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is (2S)-2-[(4-formylbenzoyl)amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[(4-formylbenzoyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 125484351 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (2S)-2-[(4-formylbenzoyl)amino]-3-hydroxypropanoic acid |
| SMILES | O=Cc1ccc(C(=O)N[C@@H](CO)C(=O)O)cc1 |
| InChI | InChI=1S/C11H11NO5/c13-5-7-1-3-8(4-2-7)10(15)12-9(6-14)11(16)17/h1-5,9,14H,6H2,(H,12,15)(H,16,17)/t9-/m0/s1 |
| InChIKey | BXHOYVAILDZBJC-VIFPVBQESA-N |
| XLogP | -0.33 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|