C17H21N5O5 — CID 118655290
2-(5-azidopentanoylamino)-4-[(4-formylphenyl)methylamino]-4-oxobutanoic acid (PubChem CID 118655290) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-(5-azidopentanoylamino)-4-[(4-formylphenyl)methylamino]-4-oxobutanoic acid.
| Compound Name | 2-(5-azidopentanoylamino)-4-[(4-formylphenyl)methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 118655290 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-(5-azidopentanoylamino)-4-[(4-formylphenyl)methylamino]-4-oxobutanoic acid |
| SMILES | [N-]=[N+]=NCCCCC(=O)NC(CC(=O)NCc1ccc(C=O)cc1)C(=O)O |
| InChI | InChI=1S/C17H21N5O5/c18-22-20-8-2-1-3-15(24)21-14(17(26)27)9-16(25)19-10-12-4-6-13(11-23)7-5-12/h4-7,11,14H,1-3,8-10H2,(H,19,25)(H,21,24)(H,26,27) |
| InChIKey | HCSURZCPAGVMOF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 161.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|