C16H22N4O4 — CID 101093773
2-(7-azidoheptanoylamino)-2-phenylmethoxyacetic acid (PubChem CID 101093773) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-(7-azidoheptanoylamino)-2-phenylmethoxyacetic acid.
| Compound Name | 2-(7-azidoheptanoylamino)-2-phenylmethoxyacetic acid |
|---|---|
| PubChem CID | 101093773 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-(7-azidoheptanoylamino)-2-phenylmethoxyacetic acid |
| SMILES | [N-]=[N+]=NCCCCCCC(=O)NC(OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H22N4O4/c17-20-18-11-7-2-1-6-10-14(21)19-15(16(22)23)24-12-13-8-4-3-5-9-13/h3-5,8-9,15H,1-2,6-7,10-12H2,(H,19,21)(H,22,23) |
| InChIKey | JFASREMHXUTZNS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|