C22H28N4O4 — CID 86753934
methyl 2-(7-azidoheptanoylamino)-2-[(1S)-1-naphthalen-2-ylethoxy]acetate (PubChem CID 86753934) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is methyl 2-(7-azidoheptanoylamino)-2-[(1S)-1-naphthalen-2-ylethoxy]acetate.
| Compound Name | methyl 2-(7-azidoheptanoylamino)-2-[(1S)-1-naphthalen-2-ylethoxy]acetate |
|---|---|
| PubChem CID | 86753934 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | methyl 2-(7-azidoheptanoylamino)-2-[(1S)-1-naphthalen-2-ylethoxy]acetate |
| SMILES | COC(=O)C(NC(=O)CCCCCCN=[N+]=[N-])O[C@@H](C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H28N4O4/c1-16(18-13-12-17-9-6-7-10-19(17)15-18)30-21(22(28)29-2)25-20(27)11-5-3-4-8-14-24-26-23/h6-7,9-10,12-13,15-16,21H,3-5,8,11,14H2,1-2H3,(H,25,27)/t16-,21?/m0/s1 |
| InChIKey | APOCDDSTXYULKK-BJQOMGFOSA-N |
| XLogP | 4.79 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|