C17H25N3O5 — CID 139443258
(2S)-2-[3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoylamino]-N-[(2S)-4-methyl-3-oxopentan-2-yl]propanamide (PubChem CID 139443258) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is (2S)-2-[3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoylamino]-N-[(2S)-4-methyl-3-oxopentan-2-yl]propanamide.
| Compound Name | (2S)-2-[3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoylamino]-N-[(2S)-4-methyl-3-oxopentan-2-yl]propanamide |
|---|---|
| PubChem CID | 139443258 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (2S)-2-[3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoylamino]-N-[(2S)-4-methyl-3-oxopentan-2-yl]propanamide |
| SMILES | CC1=CC(=O)N(CCC(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)C(C)C)C1=O |
| InChI | InChI=1S/C17H25N3O5/c1-9(2)15(23)11(4)19-16(24)12(5)18-13(21)6-7-20-14(22)8-10(3)17(20)25/h8-9,11-12H,6-7H2,1-5H3,(H,18,21)(H,19,24)/t11-,12-/m0/s1 |
| InChIKey | AOZPVGNDXUZFQR-RYUDHWBXSA-N |
| XLogP | -0.07 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|