C11H21N3O3 — CID 169205494
6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide;molecular hydrogen (PubChem CID 169205494) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide;molecular hydrogen.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide;molecular hydrogen |
|---|---|
| PubChem CID | 169205494 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide;molecular hydrogen |
| SMILES | CNNC(=O)CCCCCN1C(=O)C=CC1=O.[H][H].[H][H] |
| InChI | InChI=1S/C11H17N3O3.2H2/c1-12-13-9(15)5-3-2-4-8-14-10(16)6-7-11(14)17;;/h6-7,12H,2-5,8H2,1H3,(H,13,15);2*1H |
| InChIKey | MQUNUGYLASZDPV-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|