C13H26NO5S+ — CID 153297615
7-(2-methylpropan-2-yloxycarbonylamino)heptyl methanesulfonate (PubChem CID 153297615) has the molecular formula C13H26NO5S+ and a molecular weight of 308.42 g/mol. Its IUPAC name is 7-(2-methylpropan-2-yloxycarbonylamino)heptyl methanesulfonate.
| Compound Name | 7-(2-methylpropan-2-yloxycarbonylamino)heptyl methanesulfonate |
|---|---|
| PubChem CID | 153297615 |
| Molecular Formula | C13H26NO5S+ |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 7-(2-methylpropan-2-yloxycarbonylamino)heptyl methanesulfonate |
| SMILES | [CH2+]C(C)(C)OC(=O)NCCCCCCCOS(C)(=O)=O |
| InChI | InChI=1S/C13H25NO5S/c1-13(2,3)19-12(15)14-10-8-6-5-7-9-11-18-20(4,16)17/h1,5-11H2,2-4H3/p+1 |
| InChIKey | UNSDCFOSGKNJLE-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|