C22H38N4O5 — CID 146593247
tert-butyl (2S,3S,4S)-3-amino-4-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]amino]-2-methylpentanoate (PubChem CID 146593247) has the molecular formula C22H38N4O5 and a molecular weight of 438.57 g/mol. Its IUPAC name is tert-butyl (2S,3S,4S)-3-amino-4-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]amino]-2-methylpentanoate.
| Compound Name | tert-butyl (2S,3S,4S)-3-amino-4-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]amino]-2-methylpentanoate |
|---|---|
| PubChem CID | 146593247 |
| Molecular Formula | C22H38N4O5 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | tert-butyl (2S,3S,4S)-3-amino-4-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]amino]-2-methylpentanoate |
| SMILES | C[C@H](NCCCCCC(=O)NCCN1C(=O)C=CC1=O)[C@@H](N)[C@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H38N4O5/c1-15(21(30)31-22(3,4)5)20(23)16(2)24-12-8-6-7-9-17(27)25-13-14-26-18(28)10-11-19(26)29/h10-11,15-16,20,24H,6-9,12-14,23H2,1-5H3,(H,25,27)/t15-,16-,20-/m0/s1 |
| InChIKey | SHOZHDMCHYPEIH-FTRWYGJKSA-N |
| XLogP | 0.87 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|