C18H27N4O7PS — CID 59888435
N-[2-[2-[[5-(aminomethyl)-6-oxo-6-thiophosphorosohexyl]amino]-2-oxoethoxy]ethoxy]-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 59888435) has the molecular formula C18H27N4O7PS and a molecular weight of 474.48 g/mol. Its IUPAC name is N-[2-[2-[[5-(aminomethyl)-6-oxo-6-thiophosphorosohexyl]amino]-2-oxoethoxy]ethoxy]-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[2-[2-[[5-(aminomethyl)-6-oxo-6-thiophosphorosohexyl]amino]-2-oxoethoxy]ethoxy]-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 59888435 |
| Molecular Formula | C18H27N4O7PS |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | N-[2-[2-[[5-(aminomethyl)-6-oxo-6-thiophosphorosohexyl]amino]-2-oxoethoxy]ethoxy]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | NCC(CCCCNC(=O)COCCONC(=O)CCN1C(=O)C=CC1=O)C(=O)P=S |
| InChI | InChI=1S/C18H27N4O7PS/c19-11-13(18(27)30-31)3-1-2-7-20-15(24)12-28-9-10-29-21-14(23)6-8-22-16(25)4-5-17(22)26/h4-5,13H,1-3,6-12,19H2,(H,20,24)(H,21,23) |
| InChIKey | PAMSKCJMFOJKGH-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|