C15H21N3O7 — CID 169179123
3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-oxo-2-(2-oxoethylamino)ethoxy]ethoxy]ethyl]propanamide (PubChem CID 169179123) has the molecular formula C15H21N3O7 and a molecular weight of 355.35 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-oxo-2-(2-oxoethylamino)ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-oxo-2-(2-oxoethylamino)ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 169179123 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-oxo-2-(2-oxoethylamino)ethoxy]ethoxy]ethyl]propanamide |
| SMILES | O=CCNC(=O)COCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H21N3O7/c19-7-4-16-13(21)11-25-10-9-24-8-5-17-12(20)3-6-18-14(22)1-2-15(18)23/h1-2,7H,3-6,8-11H2,(H,16,21)(H,17,20) |
| InChIKey | KCBVNGWFJOQXID-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|