C16H27N5O5 — CID 58932741
N-[2-[2-(5,5-diaminopentylamino)-2-oxoethoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 58932741) has the molecular formula C16H27N5O5 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[2-[2-(5,5-diaminopentylamino)-2-oxoethoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[2-[2-(5,5-diaminopentylamino)-2-oxoethoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 58932741 |
| Molecular Formula | C16H27N5O5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-[2-[2-(5,5-diaminopentylamino)-2-oxoethoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | NC(N)CCCCNC(=O)COCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H27N5O5/c17-12(18)3-1-2-7-19-14(23)11-26-10-8-20-13(22)6-9-21-15(24)4-5-16(21)25/h4-5,12H,1-3,6-11,17-18H2,(H,19,23)(H,20,22) |
| InChIKey | XBGKMXMTKJTCCG-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 156.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|