C27H44N4O10 — CID 159121307
2-amino-6-[[2-[2-[5-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]-4-oxopentoxy]ethoxy]acetyl]amino]hexanamide (PubChem CID 159121307) has the molecular formula C27H44N4O10 and a molecular weight of 584.67 g/mol. Its IUPAC name is 2-amino-6-[[2-[2-[5-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]-4-oxopentoxy]ethoxy]acetyl]amino]hexanamide.
| Compound Name | 2-amino-6-[[2-[2-[5-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]-4-oxopentoxy]ethoxy]acetyl]amino]hexanamide |
|---|---|
| PubChem CID | 159121307 |
| Molecular Formula | C27H44N4O10 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 2-amino-6-[[2-[2-[5-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]-4-oxopentoxy]ethoxy]acetyl]amino]hexanamide |
| SMILES | NC(=O)C(N)CCCCNC(=O)COCCOCCCC(=O)COCCOCCCC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C27H44N4O10/c28-23(27(29)37)7-1-2-11-30-24(34)20-41-18-16-39-14-4-6-22(33)19-40-17-15-38-13-3-5-21(32)10-12-31-25(35)8-9-26(31)36/h8-9,23H,1-7,10-20,28H2,(H2,29,37)(H,30,34) |
| InChIKey | CRTAVJSMACHABQ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 206.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|