C25H43N3O4 — CID 145076481
3-methyl-1-[[4-[[(6-oxo-6-piperidin-1-ylhexyl)amino]methoxymethyl]cyclohexyl]methyl]pyrrolidine-2,5-dione (PubChem CID 145076481) has the molecular formula C25H43N3O4 and a molecular weight of 449.64 g/mol. Its IUPAC name is 3-methyl-1-[[4-[[(6-oxo-6-piperidin-1-ylhexyl)amino]methoxymethyl]cyclohexyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-1-[[4-[[(6-oxo-6-piperidin-1-ylhexyl)amino]methoxymethyl]cyclohexyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 145076481 |
| Molecular Formula | C25H43N3O4 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.33 |
| IUPAC Name | 3-methyl-1-[[4-[[(6-oxo-6-piperidin-1-ylhexyl)amino]methoxymethyl]cyclohexyl]methyl]pyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(CC2CCC(COCNCCCCCC(=O)N3CCCCC3)CC2)C1=O |
| InChI | InChI=1S/C25H43N3O4/c1-20-16-24(30)28(25(20)31)17-21-9-11-22(12-10-21)18-32-19-26-13-5-2-4-8-23(29)27-14-6-3-7-15-27/h20-22,26H,2-19H2,1H3 |
| InChIKey | JCHDQSHFZSVOFE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|