C13H19NO3 — CID 104751309
1-(2-cyclohexyl-2-oxoethyl)-3-methylpyrrolidine-2,5-dione (PubChem CID 104751309) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-(2-cyclohexyl-2-oxoethyl)-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-(2-cyclohexyl-2-oxoethyl)-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 104751309 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 1-(2-cyclohexyl-2-oxoethyl)-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(CC(=O)C2CCCCC2)C1=O |
| InChI | InChI=1S/C13H19NO3/c1-9-7-12(16)14(13(9)17)8-11(15)10-5-3-2-4-6-10/h9-10H,2-8H2,1H3 |
| InChIKey | AQHPPRINHHEYPW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|