C23H38N4O4 — CID 145076586
N-[4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexyl]-N-[6-(3-methylpyrrolidin-1-yl)-6-oxohexyl]nitrous amide (PubChem CID 145076586) has the molecular formula C23H38N4O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is N-[4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexyl]-N-[6-(3-methylpyrrolidin-1-yl)-6-oxohexyl]nitrous amide.
| Compound Name | N-[4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexyl]-N-[6-(3-methylpyrrolidin-1-yl)-6-oxohexyl]nitrous amide |
|---|---|
| PubChem CID | 145076586 |
| Molecular Formula | C23H38N4O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | N-[4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexyl]-N-[6-(3-methylpyrrolidin-1-yl)-6-oxohexyl]nitrous amide |
| SMILES | CC1CCN(C(=O)CCCCCN(N=O)C2CCC(CN3C(=O)CC(C)C3=O)CC2)C1 |
| InChI | InChI=1S/C23H38N4O4/c1-17-11-13-25(15-17)21(28)6-4-3-5-12-27(24-31)20-9-7-19(8-10-20)16-26-22(29)14-18(2)23(26)30/h17-20H,3-16H2,1-2H3 |
| InChIKey | KBVYQHXSXAAPJH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 90.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|