C29H49N3O4 — CID 145076473
4-[(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)methyl]-N-[6-oxo-6-(3-propan-2-ylpyrrolidin-1-yl)hexyl]cyclohexane-1-carboxamide (PubChem CID 145076473) has the molecular formula C29H49N3O4 and a molecular weight of 503.73 g/mol. Its IUPAC name is 4-[(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)methyl]-N-[6-oxo-6-(3-propan-2-ylpyrrolidin-1-yl)hexyl]cyclohexane-1-carboxamide.
| Compound Name | 4-[(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)methyl]-N-[6-oxo-6-(3-propan-2-ylpyrrolidin-1-yl)hexyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 145076473 |
| Molecular Formula | C29H49N3O4 |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.37 |
| IUPAC Name | 4-[(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)methyl]-N-[6-oxo-6-(3-propan-2-ylpyrrolidin-1-yl)hexyl]cyclohexane-1-carboxamide |
| SMILES | CCC(C)C1CC(=O)N(CC2CCC(C(=O)NCCCCCC(=O)N3CCC(C(C)C)C3)CC2)C1=O |
| InChI | InChI=1S/C29H49N3O4/c1-5-21(4)25-17-27(34)32(29(25)36)18-22-10-12-23(13-11-22)28(35)30-15-8-6-7-9-26(33)31-16-14-24(19-31)20(2)3/h20-25H,5-19H2,1-4H3,(H,30,35) |
| InChIKey | WODKTECFDSQOPM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|