C25H41NO9S — CID 58071238
8-[2-[2-[7-(3-ethylsulfanyl-2,5-dioxopyrrolidin-1-yl)-5-oxoheptoxy]ethoxy]ethoxy]-4-oxooctanoic acid (PubChem CID 58071238) has the molecular formula C25H41NO9S and a molecular weight of 531.67 g/mol. Its IUPAC name is 8-[2-[2-[7-(3-ethylsulfanyl-2,5-dioxopyrrolidin-1-yl)-5-oxoheptoxy]ethoxy]ethoxy]-4-oxooctanoic acid.
| Compound Name | 8-[2-[2-[7-(3-ethylsulfanyl-2,5-dioxopyrrolidin-1-yl)-5-oxoheptoxy]ethoxy]ethoxy]-4-oxooctanoic acid |
|---|---|
| PubChem CID | 58071238 |
| Molecular Formula | C25H41NO9S |
| Molecular Weight | 531.67 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 8-[2-[2-[7-(3-ethylsulfanyl-2,5-dioxopyrrolidin-1-yl)-5-oxoheptoxy]ethoxy]ethoxy]-4-oxooctanoic acid |
| SMILES | CCSC1CC(=O)N(CCC(=O)CCCCOCCOCCOCCCCC(=O)CCC(=O)O)C1=O |
| InChI | InChI=1S/C25H41NO9S/c1-2-36-22-19-23(29)26(25(22)32)12-11-21(28)8-4-6-14-34-16-18-35-17-15-33-13-5-3-7-20(27)9-10-24(30)31/h22H,2-19H2,1H3,(H,30,31) |
| InChIKey | AZPROCCABDYLHQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.67 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|