C12H18BNO5 — CID 58241713
CID 58241713 (PubChem CID 58241713) has the molecular formula C12H18BNO5 and a molecular weight of 267.09 g/mol.
| Compound Name | CID 58241713 |
|---|---|
| PubChem CID | 58241713 |
| Molecular Formula | C12H18BNO5 |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | — |
| SMILES | [B]C1CC(=O)N(CCC(=O)CCCOCCO)C1=O |
| InChI | InChI=1S/C12H18BNO5/c13-10-8-11(17)14(12(10)18)4-3-9(16)2-1-6-19-7-5-15/h10,15H,1-8H2 |
| InChIKey | SJISXFYWAASXDI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|