C25H42N2O8 — CID 162284245
2-[3-[2-[6-(2,5-dioxo-3-prop-1-en-2-ylpyrrolidin-1-yl)-4-oxohexoxy]ethoxy]propanoylamino]-3-methylbutanoic acid;ethane (PubChem CID 162284245) has the molecular formula C25H42N2O8 and a molecular weight of 498.62 g/mol. Its IUPAC name is 2-[3-[2-[6-(2,5-dioxo-3-prop-1-en-2-ylpyrrolidin-1-yl)-4-oxohexoxy]ethoxy]propanoylamino]-3-methylbutanoic acid;ethane.
| Compound Name | 2-[3-[2-[6-(2,5-dioxo-3-prop-1-en-2-ylpyrrolidin-1-yl)-4-oxohexoxy]ethoxy]propanoylamino]-3-methylbutanoic acid;ethane |
|---|---|
| PubChem CID | 162284245 |
| Molecular Formula | C25H42N2O8 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | 2-[3-[2-[6-(2,5-dioxo-3-prop-1-en-2-ylpyrrolidin-1-yl)-4-oxohexoxy]ethoxy]propanoylamino]-3-methylbutanoic acid;ethane |
| SMILES | C=C(C)C1CC(=O)N(CCC(=O)CCCOCCOCCC(=O)NC(C(=O)O)C(C)C)C1=O.CC |
| InChI | InChI=1S/C23H36N2O8.C2H6/c1-15(2)18-14-20(28)25(22(18)29)9-7-17(26)6-5-10-32-12-13-33-11-8-19(27)24-21(16(3)4)23(30)31;1-2/h16,18,21H,1,5-14H2,2-4H3,(H,24,27)(H,30,31);1-2H3 |
| InChIKey | CUHNZUFKCBXHLU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|