C12H19N3O5 — CID 119369325
(2R)-2-[4-(2,5-dioxoimidazolidin-1-yl)butanoylamino]-3-methylbutanoic acid (PubChem CID 119369325) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2R)-2-[4-(2,5-dioxoimidazolidin-1-yl)butanoylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[4-(2,5-dioxoimidazolidin-1-yl)butanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119369325 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (2R)-2-[4-(2,5-dioxoimidazolidin-1-yl)butanoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)CCCN1C(=O)CNC1=O)C(=O)O |
| InChI | InChI=1S/C12H19N3O5/c1-7(2)10(11(18)19)14-8(16)4-3-5-15-9(17)6-13-12(15)20/h7,10H,3-6H2,1-2H3,(H,13,20)(H,14,16)(H,18,19)/t10-/m1/s1 |
| InChIKey | FIZNYLGEELZZHM-SNVBAGLBSA-N |
| XLogP | -0.46 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|