C14H27ClN4O3 — CID 119597382
N-(1-amino-2,4-dimethylpentan-2-yl)-4-(2,5-dioxoimidazolidin-1-yl)butanamide;hydrochloride (PubChem CID 119597382) has the molecular formula C14H27ClN4O3 and a molecular weight of 334.85 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-4-(2,5-dioxoimidazolidin-1-yl)butanamide;hydrochloride.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4-(2,5-dioxoimidazolidin-1-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119597382 |
| Molecular Formula | C14H27ClN4O3 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4-(2,5-dioxoimidazolidin-1-yl)butanamide;hydrochloride |
| SMILES | CC(C)CC(C)(CN)NC(=O)CCCN1C(=O)CNC1=O.Cl |
| InChI | InChI=1S/C14H26N4O3.ClH/c1-10(2)7-14(3,9-15)17-11(19)5-4-6-18-12(20)8-16-13(18)21;/h10H,4-9,15H2,1-3H3,(H,16,21)(H,17,19);1H |
| InChIKey | QQWGTCJNNODEEP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|