C12H27ClN2OS — CID 119600356
N-(1-amino-2,4-dimethylpentan-2-yl)-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 119600356) has the molecular formula C12H27ClN2OS and a molecular weight of 282.88 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119600356 |
| Molecular Formula | C12H27ClN2OS |
| Molecular Weight | 282.88 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CSCCCC(=O)NC(C)(CN)CC(C)C.Cl |
| InChI | InChI=1S/C12H26N2OS.ClH/c1-10(2)8-12(3,9-13)14-11(15)6-5-7-16-4;/h10H,5-9,13H2,1-4H3,(H,14,15);1H |
| InChIKey | KSTJKSZQUNLTBO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.88 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|