C13H28N4O2 — CID 119599057
N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide (PubChem CID 119599057) has the molecular formula C13H28N4O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide |
|---|---|
| PubChem CID | 119599057 |
| Molecular Formula | C13H28N4O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)CCCCNC(N)=O |
| InChI | InChI=1S/C13H28N4O2/c1-10(2)8-13(3,9-14)17-11(18)6-4-5-7-16-12(15)19/h10H,4-9,14H2,1-3H3,(H,17,18)(H3,15,16,19) |
| InChIKey | XARYPXFJALHEHD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|