About N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide
N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide (PubChem CID 119599057) has the molecular formula C13H28N4O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide.
Molecular Properties
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide |
| PubChem CID | 119599057 |
| Molecular Formula | C13H28N4O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)CCCCNC(N)=O |
| InChI | InChI=1S/C13H28N4O2/c1-10(2)8-13(3,9-14)17-11(18)6-4-5-7-16-12(15)19/h10H,4-9,14H2,1-3H3,(H,17,18)(H3,15,16,19) |
| InChIKey | XARYPXFJALHEHD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide?
The IUPAC name of N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide (CID 119599057) is N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide.
What is the SMILES notation for N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide?
The canonical SMILES for N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide is CC(C)CC(C)(CN)NC(=O)CCCCNC(N)=O.
What is the InChIKey of N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide?
The InChIKey is XARYPXFJALHEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N4O2/c1-10(2)8-13(3,9-14)17-11(18)6-4-5-7-16-12(15)19/h10H,4-9,14H2,1-3H3,(H,17,18)(H3,15,16,19).
What are the key properties of N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide?
N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide has a molecular weight of 272.39 g/mol, XLogP of 0.70, 9 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2,4-dimethylpentan-2-yl)-5-(carbamoylamino)pentanamide is sourced from PubChem (CID 119599057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).