C53H96BN3O35P2 — CID 160900635
CID 160900635 (PubChem CID 160900635) has the molecular formula C53H96BN3O35P2 and a molecular weight of 1408.10 g/mol.
| Compound Name | CID 160900635 |
|---|---|
| PubChem CID | 160900635 |
| Molecular Formula | C53H96BN3O35P2 |
| Molecular Weight | 1408.10 g/mol |
| Exact Mass | 1407.54 |
| IUPAC Name | — |
| SMILES | COCCOCCOCCNC(=O)CC(C(=O)CCCOCCOCCOCCOC1OC(COP(=O)(O)O)C(O)C(O)C1O)C(=O)NCCOCCOCCOCCOC1OC(COP(=O)(O)O)C(O)C(O)C1O.[B]C1CC(=O)N(CCC(=O)CCCOCCO)C1=O |
| InChI | InChI=1S/C41H78N2O30P2.C12H18BNO5/c1-59-9-10-63-15-12-61-7-4-42-32(45)25-28(29(44)3-2-6-60-11-14-64-17-19-66-21-23-68-40-37(50)35(48)33(46)30(72-40)26-70-74(53,54)55)39(52)43-5-8-62-13-16-65-18-20-67-22-24-69-41-38(51)36(49)34(47)31(73-41)27-71-75(56,57)58;13-10-8-11(17)14(12(10)18)4-3-9(16)2-1-6-19-7-5-15/h28,30-31,33-38,40-41,46-51H,2-27H2,1H3,(H,42,45)(H,43,52)(H2,53,54,55)(H2,56,57,58);10,15H,1-8H2 |
| InChIKey | LTQVTZNHVMNVEW-UHFFFAOYSA-N |
| XLogP | -6.33 |
| TPSA | 534.07 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 31 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 94 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1408.10 |
| LogP ≤ 5 | -6.33 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 31 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|