C25H48BO18P — CID 90398496
CID 90398496 (PubChem CID 90398496) has the molecular formula C25H48BO18P and a molecular weight of 678.43 g/mol.
| Compound Name | CID 90398496 |
|---|---|
| PubChem CID | 90398496 |
| Molecular Formula | C25H48BO18P |
| Molecular Weight | 678.43 g/mol |
| Exact Mass | 678.27 |
| IUPAC Name | — |
| SMILES | [B]C(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOC1OC(COP(=O)(O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C25H48BO18P/c26-21(27)1-2-34-3-4-35-5-6-36-7-8-37-9-10-38-11-12-39-13-14-40-15-16-41-17-18-42-25-24(30)23(29)22(28)20(44-25)19-43-45(31,32)33/h20,22-25,28-30H,1-19H2,(H2,31,32,33) |
| InChIKey | MBZPMXRUACSYMD-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 236.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.43 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|