C29H51NO4S2 — CID 101452670
1-S,3-S-bis(2,4,4-trimethylpentan-2-yl) 2-[(3S)-1-hexyl-2,5-dioxopyrrolidin-3-yl]propanebis(thioate) (PubChem CID 101452670) has the molecular formula C29H51NO4S2 and a molecular weight of 541.86 g/mol. Its IUPAC name is 1-S,3-S-bis(2,4,4-trimethylpentan-2-yl) 2-[(3S)-1-hexyl-2,5-dioxopyrrolidin-3-yl]propanebis(thioate).
| Compound Name | 1-S,3-S-bis(2,4,4-trimethylpentan-2-yl) 2-[(3S)-1-hexyl-2,5-dioxopyrrolidin-3-yl]propanebis(thioate) |
|---|---|
| PubChem CID | 101452670 |
| Molecular Formula | C29H51NO4S2 |
| Molecular Weight | 541.86 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | 1-S,3-S-bis(2,4,4-trimethylpentan-2-yl) 2-[(3S)-1-hexyl-2,5-dioxopyrrolidin-3-yl]propanebis(thioate) |
| SMILES | CCCCCCN1C(=O)C[C@@H](C(C(=O)SC(C)(C)CC(C)(C)C)C(=O)SC(C)(C)CC(C)(C)C)C1=O |
| InChI | InChI=1S/C29H51NO4S2/c1-12-13-14-15-16-30-21(31)17-20(23(30)32)22(24(33)35-28(8,9)18-26(2,3)4)25(34)36-29(10,11)19-27(5,6)7/h20,22H,12-19H2,1-11H3/t20-/m0/s1 |
| InChIKey | HENJVLHFGFWWQB-FQEVSTJZSA-N |
| XLogP | 7.51 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.86 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|