C20H25NO5S — CID 101452678
S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-(4-methoxyphenyl)-3-oxopropanethioate (PubChem CID 101452678) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-(4-methoxyphenyl)-3-oxopropanethioate.
| Compound Name | S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-(4-methoxyphenyl)-3-oxopropanethioate |
|---|---|
| PubChem CID | 101452678 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-(4-methoxyphenyl)-3-oxopropanethioate |
| SMILES | CCN1C(=O)C[C@@H](C(C(=O)SC(C)(C)C)C(=O)c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C20H25NO5S/c1-6-21-15(22)11-14(18(21)24)16(19(25)27-20(2,3)4)17(23)12-7-9-13(26-5)10-8-12/h7-10,14,16H,6,11H2,1-5H3/t14-,16?/m0/s1 |
| InChIKey | UYCCPCFAXGIYCZ-LBAUFKAWSA-N |
| XLogP | 2.95 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|