C18H26O3S — CID 10980211
S-tert-butyl (2S,3R)-5-(4-methoxyphenyl)-2,3-dimethyl-5-oxopentanethioate (PubChem CID 10980211) has the molecular formula C18H26O3S and a molecular weight of 322.47 g/mol. Its IUPAC name is S-tert-butyl (2S,3R)-5-(4-methoxyphenyl)-2,3-dimethyl-5-oxopentanethioate.
| Compound Name | S-tert-butyl (2S,3R)-5-(4-methoxyphenyl)-2,3-dimethyl-5-oxopentanethioate |
|---|---|
| PubChem CID | 10980211 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | S-tert-butyl (2S,3R)-5-(4-methoxyphenyl)-2,3-dimethyl-5-oxopentanethioate |
| SMILES | COc1ccc(C(=O)C[C@@H](C)[C@H](C)C(=O)SC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H26O3S/c1-12(13(2)17(20)22-18(3,4)5)11-16(19)14-7-9-15(21-6)10-8-14/h7-10,12-13H,11H2,1-6H3/t12-,13+/m1/s1 |
| InChIKey | SFTKHQLKDNZBTG-OLZOCXBDSA-N |
| XLogP | 4.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|