C30H43NO3S2 — CID 12071144
1-S,7-S-ditert-butyl 3-(4-methoxyanilino)-2,6-dimethyl-5-phenylheptanebis(thioate) (PubChem CID 12071144) has the molecular formula C30H43NO3S2 and a molecular weight of 529.81 g/mol. Its IUPAC name is 1-S,7-S-ditert-butyl 3-(4-methoxyanilino)-2,6-dimethyl-5-phenylheptanebis(thioate).
| Compound Name | 1-S,7-S-ditert-butyl 3-(4-methoxyanilino)-2,6-dimethyl-5-phenylheptanebis(thioate) |
|---|---|
| PubChem CID | 12071144 |
| Molecular Formula | C30H43NO3S2 |
| Molecular Weight | 529.81 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 1-S,7-S-ditert-butyl 3-(4-methoxyanilino)-2,6-dimethyl-5-phenylheptanebis(thioate) |
| SMILES | COc1ccc(NC(CC(c2ccccc2)C(C)C(=O)SC(C)(C)C)C(C)C(=O)SC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H43NO3S2/c1-20(27(32)35-29(3,4)5)25(22-13-11-10-12-14-22)19-26(21(2)28(33)36-30(6,7)8)31-23-15-17-24(34-9)18-16-23/h10-18,20-21,25-26,31H,19H2,1-9H3 |
| InChIKey | FMUPBQQYCGKUGX-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.81 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|