C17H24N3O3+ — CID 6956177
(3S)-1-ethyl-3-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 6956177) has the molecular formula C17H24N3O3+ and a molecular weight of 318.40 g/mol. Its IUPAC name is (3S)-1-ethyl-3-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-ethyl-3-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6956177 |
| Molecular Formula | C17H24N3O3+ |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (3S)-1-ethyl-3-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)C[C@H]([NH+]2CCN(c3ccc(OC)cc3)CC2)C1=O |
| InChI | InChI=1S/C17H23N3O3/c1-3-20-16(21)12-15(17(20)22)19-10-8-18(9-11-19)13-4-6-14(23-2)7-5-13/h4-7,15H,3,8-12H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | PTCWQTALOCFFBH-HNNXBMFYSA-O |
| XLogP | -0.45 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|