C20H36N2O3 — CID 174300666
6-[3-(3-ethyl-4-methylheptan-3-yl)-2,5-dioxopyrrolidin-1-yl]hexanamide (PubChem CID 174300666) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is 6-[3-(3-ethyl-4-methylheptan-3-yl)-2,5-dioxopyrrolidin-1-yl]hexanamide.
| Compound Name | 6-[3-(3-ethyl-4-methylheptan-3-yl)-2,5-dioxopyrrolidin-1-yl]hexanamide |
|---|---|
| PubChem CID | 174300666 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 6-[3-(3-ethyl-4-methylheptan-3-yl)-2,5-dioxopyrrolidin-1-yl]hexanamide |
| SMILES | CCCC(C)C(CC)(CC)C1CC(=O)N(CCCCCC(N)=O)C1=O |
| InChI | InChI=1S/C20H36N2O3/c1-5-11-15(4)20(6-2,7-3)16-14-18(24)22(19(16)25)13-10-8-9-12-17(21)23/h15-16H,5-14H2,1-4H3,(H2,21,23) |
| InChIKey | KHVRZVWMJIMQMH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|