C16H35N2O2+ — CID 177060891
dimethyl-[2-[[4-methyl-4-(3-methylpentoxy)pentanoyl]amino]ethyl]azanium (PubChem CID 177060891) has the molecular formula C16H35N2O2+ and a molecular weight of 287.47 g/mol. Its IUPAC name is dimethyl-[2-[[4-methyl-4-(3-methylpentoxy)pentanoyl]amino]ethyl]azanium.
| Compound Name | dimethyl-[2-[[4-methyl-4-(3-methylpentoxy)pentanoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 177060891 |
| Molecular Formula | C16H35N2O2+ |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.27 |
| IUPAC Name | dimethyl-[2-[[4-methyl-4-(3-methylpentoxy)pentanoyl]amino]ethyl]azanium |
| SMILES | CCC(C)CCOC(C)(C)CCC(=O)NCC[NH+](C)C |
| InChI | InChI=1S/C16H34N2O2/c1-7-14(2)9-13-20-16(3,4)10-8-15(19)17-11-12-18(5)6/h14H,7-13H2,1-6H3,(H,17,19)/p+1 |
| InChIKey | FMILQTPDBIAZCV-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |