C30H60N8O12 — CID 126761941
N,N'-bis[2-(2-aminooxyethoxy)ethyl]-2-[[5-[2-(2-aminooxyethoxy)ethylamino]-4-[(4-ethoxy-4-methylpentanoyl)amino]-5-oxopentanoyl]amino]pentanediamide (PubChem CID 126761941) has the molecular formula C30H60N8O12 and a molecular weight of 724.85 g/mol. Its IUPAC name is N,N'-bis[2-(2-aminooxyethoxy)ethyl]-2-[[5-[2-(2-aminooxyethoxy)ethylamino]-4-[(4-ethoxy-4-methylpentanoyl)amino]-5-oxopentanoyl]amino]pentanediamide.
| Compound Name | N,N'-bis[2-(2-aminooxyethoxy)ethyl]-2-[[5-[2-(2-aminooxyethoxy)ethylamino]-4-[(4-ethoxy-4-methylpentanoyl)amino]-5-oxopentanoyl]amino]pentanediamide |
|---|---|
| PubChem CID | 126761941 |
| Molecular Formula | C30H60N8O12 |
| Molecular Weight | 724.85 g/mol |
| Exact Mass | 724.43 |
| IUPAC Name | N,N'-bis[2-(2-aminooxyethoxy)ethyl]-2-[[5-[2-(2-aminooxyethoxy)ethylamino]-4-[(4-ethoxy-4-methylpentanoyl)amino]-5-oxopentanoyl]amino]pentanediamide |
| SMILES | CCOC(C)(C)CCC(=O)NC(CCC(=O)NC(CCC(=O)NCCOCCON)C(=O)NCCOCCON)C(=O)NCCOCCON |
| InChI | InChI=1S/C30H60N8O12/c1-4-47-30(2,3)10-9-27(41)38-24(29(43)36-13-16-46-19-22-50-33)6-8-26(40)37-23(28(42)35-12-15-45-18-21-49-32)5-7-25(39)34-11-14-44-17-20-48-31/h23-24H,4-22,31-33H2,1-3H3,(H,34,39)(H,35,42)(H,36,43)(H,37,40)(H,38,41) |
| InChIKey | LCQPGMYFNJOCQV-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 288.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.85 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|