C27H54N2O5 — CID 167634411
N-[(2S)-5,5-dimethyl-1-oxo-1-[2-[2-(2-propoxyethoxy)ethoxy]ethylamino]hexan-2-yl]-7,7-dimethyloctanamide (PubChem CID 167634411) has the molecular formula C27H54N2O5 and a molecular weight of 486.74 g/mol. Its IUPAC name is N-[(2S)-5,5-dimethyl-1-oxo-1-[2-[2-(2-propoxyethoxy)ethoxy]ethylamino]hexan-2-yl]-7,7-dimethyloctanamide.
| Compound Name | N-[(2S)-5,5-dimethyl-1-oxo-1-[2-[2-(2-propoxyethoxy)ethoxy]ethylamino]hexan-2-yl]-7,7-dimethyloctanamide |
|---|---|
| PubChem CID | 167634411 |
| Molecular Formula | C27H54N2O5 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.40 |
| IUPAC Name | N-[(2S)-5,5-dimethyl-1-oxo-1-[2-[2-(2-propoxyethoxy)ethoxy]ethylamino]hexan-2-yl]-7,7-dimethyloctanamide |
| SMILES | CCCOCCOCCOCCNC(=O)[C@H](CCC(C)(C)C)NC(=O)CCCCCC(C)(C)C |
| InChI | InChI=1S/C27H54N2O5/c1-8-17-32-19-21-34-22-20-33-18-16-28-25(31)23(13-15-27(5,6)7)29-24(30)12-10-9-11-14-26(2,3)4/h23H,8-22H2,1-7H3,(H,28,31)(H,29,30)/t23-/m0/s1 |
| InChIKey | OGNOTSUNRSZKAQ-QHCPKHFHSA-N |
| XLogP | 4.87 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|