C27H54N2O4 — CID 166040073
(2S)-N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-2-(4,4-dimethylpentanoylamino)-7,7-dimethyloctanamide (PubChem CID 166040073) has the molecular formula C27H54N2O4 and a molecular weight of 470.74 g/mol. Its IUPAC name is (2S)-N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-2-(4,4-dimethylpentanoylamino)-7,7-dimethyloctanamide.
| Compound Name | (2S)-N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-2-(4,4-dimethylpentanoylamino)-7,7-dimethyloctanamide |
|---|---|
| PubChem CID | 166040073 |
| Molecular Formula | C27H54N2O4 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.41 |
| IUPAC Name | (2S)-N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-2-(4,4-dimethylpentanoylamino)-7,7-dimethyloctanamide |
| SMILES | CC(C)(C)CCCC[C@H](NC(=O)CCC(C)(C)C)C(=O)NCCOCCOCCC(C)(C)C |
| InChI | InChI=1S/C27H54N2O4/c1-25(2,3)14-11-10-12-22(29-23(30)13-15-26(4,5)6)24(31)28-17-19-33-21-20-32-18-16-27(7,8)9/h22H,10-21H2,1-9H3,(H,28,31)(H,29,30)/t22-/m0/s1 |
| InChIKey | BIVMMHWHLKFXJM-QFIPXVFZSA-N |
| XLogP | 5.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|