C35H69N8O15P — CID 155134875
6-[[5-[[1,10-bis[2-(2-aminooxyethoxy)ethylamino]-7-[2-(2-aminooxyethoxy)ethylcarbamoyl]-1,5,10-trioxodecan-2-yl]amino]-5-oxopentanoyl]amino]hexoxy-methylphosphinic acid (PubChem CID 155134875) has the molecular formula C35H69N8O15P and a molecular weight of 872.95 g/mol. Its IUPAC name is 6-[[5-[[1,10-bis[2-(2-aminooxyethoxy)ethylamino]-7-[2-(2-aminooxyethoxy)ethylcarbamoyl]-1,5,10-trioxodecan-2-yl]amino]-5-oxopentanoyl]amino]hexoxy-methylphosphinic acid.
| Compound Name | 6-[[5-[[1,10-bis[2-(2-aminooxyethoxy)ethylamino]-7-[2-(2-aminooxyethoxy)ethylcarbamoyl]-1,5,10-trioxodecan-2-yl]amino]-5-oxopentanoyl]amino]hexoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 155134875 |
| Molecular Formula | C35H69N8O15P |
| Molecular Weight | 872.95 g/mol |
| Exact Mass | 872.46 |
| IUPAC Name | 6-[[5-[[1,10-bis[2-(2-aminooxyethoxy)ethylamino]-7-[2-(2-aminooxyethoxy)ethylcarbamoyl]-1,5,10-trioxodecan-2-yl]amino]-5-oxopentanoyl]amino]hexoxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OCCCCCCNC(=O)CCCC(=O)NC(CCC(=O)CC(CCC(=O)NCCOCCON)C(=O)NCCOCCON)C(=O)NCCOCCON |
| InChI | InChI=1S/C35H69N8O15P/c1-59(50,51)58-17-5-3-2-4-13-39-31(45)7-6-8-33(47)43-30(35(49)42-16-20-54-23-26-57-38)11-10-29(44)27-28(34(48)41-15-19-53-22-25-56-37)9-12-32(46)40-14-18-52-21-24-55-36/h28,30H,2-27,36-38H2,1H3,(H,39,45)(H,40,46)(H,41,48)(H,42,49)(H,43,47)(H,50,51) |
| InChIKey | KYYLPESPAXLHPW-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 342.54 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.95 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|