C37H69N4O13PS — CID 174336699
1-N,3-N,8-N-tris[2-(2-methoxyethoxy)ethyl]-8-[[4-[methylsulfanyl(propan-2-yl)phosphoryl]oxycyclohexanecarbonyl]amino]-5-oxooctane-1,3,8-tricarboxamide (PubChem CID 174336699) has the molecular formula C37H69N4O13PS and a molecular weight of 841.01 g/mol. Its IUPAC name is 1-N,3-N,8-N-tris[2-(2-methoxyethoxy)ethyl]-8-[[4-[methylsulfanyl(propan-2-yl)phosphoryl]oxycyclohexanecarbonyl]amino]-5-oxooctane-1,3,8-tricarboxamide.
| Compound Name | 1-N,3-N,8-N-tris[2-(2-methoxyethoxy)ethyl]-8-[[4-[methylsulfanyl(propan-2-yl)phosphoryl]oxycyclohexanecarbonyl]amino]-5-oxooctane-1,3,8-tricarboxamide |
|---|---|
| PubChem CID | 174336699 |
| Molecular Formula | C37H69N4O13PS |
| Molecular Weight | 841.01 g/mol |
| Exact Mass | 840.43 |
| IUPAC Name | 1-N,3-N,8-N-tris[2-(2-methoxyethoxy)ethyl]-8-[[4-[methylsulfanyl(propan-2-yl)phosphoryl]oxycyclohexanecarbonyl]amino]-5-oxooctane-1,3,8-tricarboxamide |
| SMILES | COCCOCCNC(=O)CCC(CC(=O)CCC(NC(=O)C1CCC(OP(=O)(SC)C(C)C)CC1)C(=O)NCCOCCOC)C(=O)NCCOCCOC |
| InChI | InChI=1S/C37H69N4O13PS/c1-28(2)55(47,56-6)54-32-11-7-29(8-12-32)36(45)41-33(37(46)40-17-20-53-26-23-50-5)13-10-31(42)27-30(35(44)39-16-19-52-25-22-49-4)9-14-34(43)38-15-18-51-24-21-48-3/h28-30,32-33H,7-27H2,1-6H3,(H,38,43)(H,39,44)(H,40,46)(H,41,45) |
| InChIKey | NAMVYVIXLKSVQI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 215.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.01 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|