C31H60N7O13PS — CID 174337594
1-N,3-N,7-N-tris[2-(2-aminooxyethoxy)ethyl]-7-[[4-[methyl(methylsulfanyl)phosphoryl]oxycyclohexanecarbonyl]amino]-4-oxoheptane-1,3,7-tricarboxamide (PubChem CID 174337594) has the molecular formula C31H60N7O13PS and a molecular weight of 801.90 g/mol. Its IUPAC name is 1-N,3-N,7-N-tris[2-(2-aminooxyethoxy)ethyl]-7-[[4-[methyl(methylsulfanyl)phosphoryl]oxycyclohexanecarbonyl]amino]-4-oxoheptane-1,3,7-tricarboxamide.
| Compound Name | 1-N,3-N,7-N-tris[2-(2-aminooxyethoxy)ethyl]-7-[[4-[methyl(methylsulfanyl)phosphoryl]oxycyclohexanecarbonyl]amino]-4-oxoheptane-1,3,7-tricarboxamide |
|---|---|
| PubChem CID | 174337594 |
| Molecular Formula | C31H60N7O13PS |
| Molecular Weight | 801.90 g/mol |
| Exact Mass | 801.37 |
| IUPAC Name | 1-N,3-N,7-N-tris[2-(2-aminooxyethoxy)ethyl]-7-[[4-[methyl(methylsulfanyl)phosphoryl]oxycyclohexanecarbonyl]amino]-4-oxoheptane-1,3,7-tricarboxamide |
| SMILES | CSP(C)(=O)OC1CCC(C(=O)NC(CCC(=O)C(CCC(=O)NCCOCCON)C(=O)NCCOCCON)C(=O)NCCOCCON)CC1 |
| InChI | InChI=1S/C31H60N7O13PS/c1-52(44,53-2)51-24-5-3-23(4-6-24)29(41)38-26(31(43)37-13-16-47-19-22-50-34)8-9-27(39)25(30(42)36-12-15-46-18-21-49-33)7-10-28(40)35-11-14-45-17-20-48-32/h23-26H,3-22,32-34H2,1-2H3,(H,35,40)(H,36,42)(H,37,43)(H,38,41) |
| InChIKey | RKYKESNECYMQKC-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 293.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.90 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|